C18H30N2O4S — CID 86818230
2-(4-methoxyphenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)ethanesulfonamide (PubChem CID 86818230) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)ethanesulfonamide.
| Compound Name | 2-(4-methoxyphenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)ethanesulfonamide |
|---|---|
| PubChem CID | 86818230 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)ethanesulfonamide |
| SMILES | COc1ccc(CCS(=O)(=O)NCC(C(C)C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H30N2O4S/c1-15(2)18(20-9-11-24-12-10-20)14-19-25(21,22)13-8-16-4-6-17(23-3)7-5-16/h4-7,15,18-19H,8-14H2,1-3H3 |
| InChIKey | CVTHOHVNRRBYCE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |