C20H31BrN2O2 — CID 55758909
5-(4-bromophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)pentanamide (PubChem CID 55758909) has the molecular formula C20H31BrN2O2 and a molecular weight of 411.38 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)pentanamide |
|---|---|
| PubChem CID | 55758909 |
| Molecular Formula | C20H31BrN2O2 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 5-(4-bromophenyl)-N-(3-methyl-2-morpholin-4-ylbutyl)pentanamide |
| SMILES | CC(C)C(CNC(=O)CCCCc1ccc(Br)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H31BrN2O2/c1-16(2)19(23-11-13-25-14-12-23)15-22-20(24)6-4-3-5-17-7-9-18(21)10-8-17/h7-10,16,19H,3-6,11-15H2,1-2H3,(H,22,24) |
| InChIKey | YKBXHTJXPDUYEF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|