About 5-(4-bromophenyl)-N'-methylpentanehydrazide
5-(4-bromophenyl)-N'-methylpentanehydrazide (PubChem CID 116846599) has the molecular formula C12H17BrN2O
and a molecular weight of 285.19 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N'-methylpentanehydrazide.
Molecular Properties
| Compound Name | 5-(4-bromophenyl)-N'-methylpentanehydrazide |
| PubChem CID | 116846599 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-(4-bromophenyl)-N'-methylpentanehydrazide |
| SMILES | CNNC(=O)CCCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrN2O/c1-14-15-12(16)5-3-2-4-10-6-8-11(13)9-7-10/h6-9,14H,2-5H2,1H3,(H,15,16) |
| InChIKey | COMJCNWNJXUHOM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-bromophenyl)-N'-methylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromophenyl)-N'-methylpentanehydrazide?
The IUPAC name of 5-(4-bromophenyl)-N'-methylpentanehydrazide (CID 116846599) is 5-(4-bromophenyl)-N'-methylpentanehydrazide.
What is the SMILES notation for 5-(4-bromophenyl)-N'-methylpentanehydrazide?
The canonical SMILES for 5-(4-bromophenyl)-N'-methylpentanehydrazide is CNNC(=O)CCCCc1ccc(Br)cc1.
What is the InChIKey of 5-(4-bromophenyl)-N'-methylpentanehydrazide?
The InChIKey is COMJCNWNJXUHOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O/c1-14-15-12(16)5-3-2-4-10-6-8-11(13)9-7-10/h6-9,14H,2-5H2,1H3,(H,15,16).
What are the key properties of 5-(4-bromophenyl)-N'-methylpentanehydrazide?
5-(4-bromophenyl)-N'-methylpentanehydrazide has a molecular weight of 285.19 g/mol, XLogP of 2.41, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromophenyl)-N'-methylpentanehydrazide is sourced from PubChem (CID 116846599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).