C13H18N4O2 — CID 116846652
N'-methyl-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pentanehydrazide (PubChem CID 116846652) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is N'-methyl-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pentanehydrazide.
| Compound Name | N'-methyl-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pentanehydrazide |
|---|---|
| PubChem CID | 116846652 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | N'-methyl-5-(2-oxo-1,3-dihydrobenzimidazol-5-yl)pentanehydrazide |
| SMILES | CNNC(=O)CCCCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H18N4O2/c1-14-17-12(18)5-3-2-4-9-6-7-10-11(8-9)16-13(19)15-10/h6-8,14H,2-5H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | XVJDXZXQXIWZRD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|