C11H13ClN2O — CID 87983574
5-(4-chlorobutyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 87983574) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is 5-(4-chlorobutyl)-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-(4-chlorobutyl)-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 87983574 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 5-(4-chlorobutyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(CCCCCl)cc2[nH]1 |
| InChI | InChI=1S/C11H13ClN2O/c12-6-2-1-3-8-4-5-9-10(7-8)14-11(15)13-9/h4-5,7H,1-3,6H2,(H2,13,14,15) |
| InChIKey | QICOXHROZDSNOB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|