C13H16N4O — CID 115231960
4-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]butanenitrile (PubChem CID 115231960) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 4-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]butanenitrile.
| Compound Name | 4-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]butanenitrile |
|---|---|
| PubChem CID | 115231960 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 4-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethylamino]butanenitrile |
| SMILES | N#CCCCNCCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H16N4O/c14-6-1-2-7-15-8-5-10-3-4-11-12(9-10)17-13(18)16-11/h3-4,9,15H,1-2,5,7-8H2,(H2,16,17,18) |
| InChIKey | SYOSNKSNWDAJJX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|