C11H10N4O2 — CID 115172542
1-cyano-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]formamide (PubChem CID 115172542) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-cyano-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]formamide.
| Compound Name | 1-cyano-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]formamide |
|---|---|
| PubChem CID | 115172542 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-cyano-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]formamide |
| SMILES | N#CC(=O)NCCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H10N4O2/c12-6-10(16)13-4-3-7-1-2-8-9(5-7)15-11(17)14-8/h1-2,5H,3-4H2,(H,13,16)(H2,14,15,17) |
| InChIKey | PYLRVEVDZHDAAW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|