C14H20N4O2 — CID 110776173
1-tert-butyl-3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]urea (PubChem CID 110776173) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]urea |
|---|---|
| PubChem CID | 110776173 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 1-tert-butyl-3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]urea |
| SMILES | CC(C)(C)NC(=O)NCCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H20N4O2/c1-14(2,3)18-12(19)15-7-6-9-4-5-10-11(8-9)17-13(20)16-10/h4-5,8H,6-7H2,1-3H3,(H2,15,18,19)(H2,16,17,20) |
| InChIKey | VKQIPKQIHUZHFD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |