C13H20N4O — CID 115136177
5-[2-[(2-amino-2-methylpropyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one (PubChem CID 115136177) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 5-[2-[(2-amino-2-methylpropyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[2-[(2-amino-2-methylpropyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 115136177 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 5-[2-[(2-amino-2-methylpropyl)amino]ethyl]-1,3-dihydrobenzimidazol-2-one |
| SMILES | CC(C)(N)CNCCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C13H20N4O/c1-13(2,14)8-15-6-5-9-3-4-10-11(7-9)17-12(18)16-10/h3-4,7,15H,5-6,8,14H2,1-2H3,(H2,16,17,18) |
| InChIKey | RLVCYDBKHFNXPL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|