C11H12N4O — CID 117043544
methyl-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]cyanamide (PubChem CID 117043544) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is methyl-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]cyanamide.
| Compound Name | methyl-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]cyanamide |
|---|---|
| PubChem CID | 117043544 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | methyl-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]cyanamide |
| SMILES | CN(C#N)CCc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C11H12N4O/c1-15(7-12)5-4-8-2-3-9-10(6-8)14-11(16)13-9/h2-3,6H,4-5H2,1H3,(H2,13,14,16) |
| InChIKey | DNKHHLITMZZUAD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|