C12H14ClN3O2 — CID 115162212
2-chloro-N-methyl-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]acetamide (PubChem CID 115162212) has the molecular formula C12H14ClN3O2 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]acetamide.
| Compound Name | 2-chloro-N-methyl-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 115162212 |
| Molecular Formula | C12H14ClN3O2 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-chloro-N-methyl-N-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]acetamide |
| SMILES | CN(CCc1ccc2[nH]c(=O)[nH]c2c1)C(=O)CCl |
| InChI | InChI=1S/C12H14ClN3O2/c1-16(11(17)7-13)5-4-8-2-3-9-10(6-8)15-12(18)14-9/h2-3,6H,4-5,7H2,1H3,(H2,14,15,18) |
| InChIKey | ZRQLRDGDEHBYFX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|