C37H48ClN5O3 — CID 59124373
2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-[4-[(6-chloro-1,3-benzoxazol-2-yl)diazenyl]-N-ethyl-2-methylanilino]ethyl]propanamide (PubChem CID 59124373) has the molecular formula C37H48ClN5O3 and a molecular weight of 646.28 g/mol. Its IUPAC name is 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-[4-[(6-chloro-1,3-benzoxazol-2-yl)diazenyl]-N-ethyl-2-methylanilino]ethyl]propanamide.
| Compound Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-[4-[(6-chloro-1,3-benzoxazol-2-yl)diazenyl]-N-ethyl-2-methylanilino]ethyl]propanamide |
|---|---|
| PubChem CID | 59124373 |
| Molecular Formula | C37H48ClN5O3 |
| Molecular Weight | 646.28 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]-N-[2-[4-[(6-chloro-1,3-benzoxazol-2-yl)diazenyl]-N-ethyl-2-methylanilino]ethyl]propanamide |
| SMILES | CCN(CCNC(=O)C(C)Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)c1ccc(/N=N/c2nc3ccc(Cl)cc3o2)cc1C |
| InChI | InChI=1S/C37H48ClN5O3/c1-10-36(6,7)26-13-18-32(29(22-26)37(8,9)11-2)45-25(5)34(44)39-19-20-43(12-3)31-17-15-28(21-24(31)4)41-42-35-40-30-16-14-27(38)23-33(30)46-35/h13-18,21-23,25H,10-12,19-20H2,1-9H3,(H,39,44)/b42-41+ |
| InChIKey | JWUMNUPVSVWRDI-WQVHNPAPSA-N |
| XLogP | 9.99 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.28 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|