C31H33N7O4S — CID 58776973
3-[[4-[6-tert-butyl-7-[4-(diethylamino)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid (PubChem CID 58776973) has the molecular formula C31H33N7O4S and a molecular weight of 599.72 g/mol. Its IUPAC name is 3-[[4-[6-tert-butyl-7-[4-(diethylamino)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[6-tert-butyl-7-[4-(diethylamino)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58776973 |
| Molecular Formula | C31H33N7O4S |
| Molecular Weight | 599.72 g/mol |
| Exact Mass | 599.23 |
| IUPAC Name | 3-[[4-[6-tert-butyl-7-[4-(diethylamino)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid |
| SMILES | CCN(CC)c1ccc(/N=C2/C(C(C)(C)C)=Nn3nc(-c4ccc(NC(=O)c5cccc(S(=O)(=O)O)c5)cc4)nc32)cc1 |
| InChI | InChI=1S/C31H33N7O4S/c1-6-37(7-2)24-17-15-22(16-18-24)32-26-27(31(3,4)5)35-38-29(26)34-28(36-38)20-11-13-23(14-12-20)33-30(39)21-9-8-10-25(19-21)43(40,41)42/h8-19H,6-7H2,1-5H3,(H,33,39)(H,40,41,42)/b32-26- |
| InChIKey | NORROBUNKMOCHH-FSRJSHLRSA-N |
| XLogP | 5.67 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.72 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|