C32H32F3N7O4S — CID 58776874
3-[[4-[6-tert-butyl-7-[4-(diethylamino)-2-(trifluoromethyl)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid (PubChem CID 58776874) has the molecular formula C32H32F3N7O4S and a molecular weight of 667.71 g/mol. Its IUPAC name is 3-[[4-[6-tert-butyl-7-[4-(diethylamino)-2-(trifluoromethyl)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[6-tert-butyl-7-[4-(diethylamino)-2-(trifluoromethyl)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 58776874 |
| Molecular Formula | C32H32F3N7O4S |
| Molecular Weight | 667.71 g/mol |
| Exact Mass | 667.22 |
| IUPAC Name | 3-[[4-[6-tert-butyl-7-[4-(diethylamino)-2-(trifluoromethyl)phenyl]iminopyrazolo[1,5-b][1,2,4]triazol-2-yl]phenyl]carbamoyl]benzenesulfonic acid |
| SMILES | CCN(CC)c1ccc(/N=C2/C(C(C)(C)C)=Nn3nc(-c4ccc(NC(=O)c5cccc(S(=O)(=O)O)c5)cc4)nc32)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H32F3N7O4S/c1-6-41(7-2)22-15-16-25(24(18-22)32(33,34)35)37-26-27(31(3,4)5)39-42-29(26)38-28(40-42)19-11-13-21(14-12-19)36-30(43)20-9-8-10-23(17-20)47(44,45)46/h8-18H,6-7H2,1-5H3,(H,36,43)(H,44,45,46)/b37-26- |
| InChIKey | DYURSTXRBCGMPH-UOZKZNBHSA-N |
| XLogP | 6.69 |
| TPSA | 142.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|