C41H60N8O5S — CID 59705946
[2-[4-[7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]anilino]-2-oxoethyl] 2-hexyldecanoate (PubChem CID 59705946) has the molecular formula C41H60N8O5S and a molecular weight of 777.05 g/mol. Its IUPAC name is [2-[4-[7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]anilino]-2-oxoethyl] 2-hexyldecanoate.
| Compound Name | [2-[4-[7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]anilino]-2-oxoethyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 59705946 |
| Molecular Formula | C41H60N8O5S |
| Molecular Weight | 777.05 g/mol |
| Exact Mass | 776.44 |
| IUPAC Name | [2-[4-[7-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-6-methylpyrazolo[1,5-b][1,2,4]triazol-2-yl]anilino]-2-oxoethyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCC(=O)Nc1ccc(-c2nc3n(n2)N=C(C)/C3=N\c2ccc(N(CC)CCNS(C)(=O)=O)cc2C)cc1 |
| InChI | InChI=1S/C41H60N8O5S/c1-7-10-12-14-15-17-19-33(18-16-13-11-8-2)41(51)54-29-37(50)43-34-22-20-32(21-23-34)39-45-40-38(31(5)46-49(40)47-39)44-36-25-24-35(28-30(36)4)48(9-3)27-26-42-55(6,52)53/h20-25,28,33,42H,7-19,26-27,29H2,1-6H3,(H,43,50)/b44-38+ |
| InChIKey | HFOYNPWZFHOFKV-PDHICSTQSA-N |
| XLogP | 7.81 |
| TPSA | 160.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.05 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|