C26H32N6O — CID 58693435
2-[4-[[6-tert-butyl-2-(4-methylphenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethyl-3-methylanilino]ethanol (PubChem CID 58693435) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-[4-[[6-tert-butyl-2-(4-methylphenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethyl-3-methylanilino]ethanol.
| Compound Name | 2-[4-[[6-tert-butyl-2-(4-methylphenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethyl-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 58693435 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | 2-[4-[[6-tert-butyl-2-(4-methylphenyl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-N-ethyl-3-methylanilino]ethanol |
| SMILES | CCN(CCO)c1ccc(/N=C2/C(C(C)(C)C)=Nn3nc(-c4ccc(C)cc4)nc32)c(C)c1 |
| InChI | InChI=1S/C26H32N6O/c1-7-31(14-15-33)20-12-13-21(18(3)16-20)27-22-23(26(4,5)6)29-32-25(22)28-24(30-32)19-10-8-17(2)9-11-19/h8-13,16,33H,7,14-15H2,1-6H3/b27-22- |
| InChIKey | MEPXOAQTVZKTBF-QYQHSDTDSA-N |
| XLogP | 4.77 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|