C21H18F7N7S — CID 58621634
N,N-diethyl-4-[[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,3-thiazol-2-yl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-3-methylaniline (PubChem CID 58621634) has the molecular formula C21H18F7N7S and a molecular weight of 533.48 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,3-thiazol-2-yl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-3-methylaniline.
| Compound Name | N,N-diethyl-4-[[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,3-thiazol-2-yl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-3-methylaniline |
|---|---|
| PubChem CID | 58621634 |
| Molecular Formula | C21H18F7N7S |
| Molecular Weight | 533.48 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | N,N-diethyl-4-[[6-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-(1,3-thiazol-2-yl)pyrazolo[1,5-b][1,2,4]triazol-7-ylidene]amino]-3-methylaniline |
| SMILES | CCN(CC)c1ccc(/N=C2/C(C(F)(C(F)(F)F)C(F)(F)F)=Nn3nc(-c4nccs4)nc32)c(C)c1 |
| InChI | InChI=1S/C21H18F7N7S/c1-4-34(5-2)12-6-7-13(11(3)10-12)30-14-15(19(22,20(23,24)25)21(26,27)28)32-35-17(14)31-16(33-35)18-29-8-9-36-18/h6-10H,4-5H2,1-3H3/b30-14- |
| InChIKey | XZUQCEUKZQTLKN-CPDSRJINSA-N |
| XLogP | 5.73 |
| TPSA | 71.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|