C34H39ClN6O5S — CID 23382975
3-(3-butyl-2-oxo-4-phenyl-1H-imidazol-5-yl)-N-(2-chlorophenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-oxopropanamide (PubChem CID 23382975) has the molecular formula C34H39ClN6O5S and a molecular weight of 679.24 g/mol. Its IUPAC name is 3-(3-butyl-2-oxo-4-phenyl-1H-imidazol-5-yl)-N-(2-chlorophenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-oxopropanamide.
| Compound Name | 3-(3-butyl-2-oxo-4-phenyl-1H-imidazol-5-yl)-N-(2-chlorophenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-oxopropanamide |
|---|---|
| PubChem CID | 23382975 |
| Molecular Formula | C34H39ClN6O5S |
| Molecular Weight | 679.24 g/mol |
| Exact Mass | 678.24 |
| IUPAC Name | 3-(3-butyl-2-oxo-4-phenyl-1H-imidazol-5-yl)-N-(2-chlorophenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-oxopropanamide |
| SMILES | CCCCn1c(-c2ccccc2)c(C(=O)/C(=N/c2ccc(N(CC)CCNS(C)(=O)=O)cc2C)C(=O)Nc2ccccc2Cl)[nH]c1=O |
| InChI | InChI=1S/C34H39ClN6O5S/c1-5-7-20-41-31(24-13-9-8-10-14-24)29(39-34(41)44)32(42)30(33(43)38-28-16-12-11-15-26(28)35)37-27-18-17-25(22-23(27)3)40(6-2)21-19-36-47(4,45)46/h8-18,22,36H,5-7,19-21H2,1-4H3,(H,38,43)(H,39,44)/b37-30- |
| InChIKey | XNDDREALUMTSAO-ONQIKCEGSA-N |
| XLogP | 5.57 |
| TPSA | 145.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.24 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|