C40H45N5O4S — CID 23383006
N-(4-butylphenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-(1-methyl-2-phenylindol-3-yl)-3-oxopropanamide (PubChem CID 23383006) has the molecular formula C40H45N5O4S and a molecular weight of 691.90 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-(1-methyl-2-phenylindol-3-yl)-3-oxopropanamide.
| Compound Name | N-(4-butylphenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-(1-methyl-2-phenylindol-3-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 23383006 |
| Molecular Formula | C40H45N5O4S |
| Molecular Weight | 691.90 g/mol |
| Exact Mass | 691.32 |
| IUPAC Name | N-(4-butylphenyl)-2-[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]imino-3-(1-methyl-2-phenylindol-3-yl)-3-oxopropanamide |
| SMILES | CCCCc1ccc(NC(=O)/C(=N\c2ccc(N(CC)CCNS(C)(=O)=O)cc2C)C(=O)c2c(-c3ccccc3)n(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C40H45N5O4S/c1-6-8-14-29-19-21-31(22-20-29)42-40(47)37(43-34-24-23-32(27-28(34)3)45(7-2)26-25-41-50(5,48)49)39(46)36-33-17-12-13-18-35(33)44(4)38(36)30-15-10-9-11-16-30/h9-13,15-24,27,41H,6-8,14,25-26H2,1-5H3,(H,42,47)/b43-37- |
| InChIKey | FFLQJYHASCURSX-KRVRMENKSA-N |
| XLogP | 7.47 |
| TPSA | 112.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.90 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|