C9H16O3S — CID 22902046
2-acetylsulfanyl-3,4-dimethylpentanoic acid (PubChem CID 22902046) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 2-acetylsulfanyl-3,4-dimethylpentanoic acid.
| Compound Name | 2-acetylsulfanyl-3,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 22902046 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-acetylsulfanyl-3,4-dimethylpentanoic acid |
| SMILES | CC(=O)SC(C(=O)O)C(C)C(C)C |
| InChI | InChI=1S/C9H16O3S/c1-5(2)6(3)8(9(11)12)13-7(4)10/h5-6,8H,1-4H3,(H,11,12) |
| InChIKey | MWKLQXCRFGCDRT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|