4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid

C11H18F4O2S — CID 87340067

IUPAC4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid
SMILESCC(C)CC(SCCCC(F)(F)C(F)F)C(=O)O
InChIInChI=1S/C11H18F4O2S/c1-7(2)6-8(9(16)17)18-5-3-4-11(14,15)10(12)13/h7-8,10H,3-6H2,1-2H3,(H,16,17)
InChIKeyFDTUNEPZXUYIKR-UHFFFAOYSA-N
MW290.32 g/mol
LogP3.90
Rot. Bonds9

About 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid

4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid (PubChem CID 87340067) has the molecular formula C11H18F4O2S and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid.

Molecular Properties

Compound Name4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid
PubChem CID87340067
Molecular FormulaC11H18F4O2S
Molecular Weight290.32 g/mol
Exact Mass290.10
IUPAC Name4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid
SMILESCC(C)CC(SCCCC(F)(F)C(F)F)C(=O)O
InChIInChI=1S/C11H18F4O2S/c1-7(2)6-8(9(16)17)18-5-3-4-11(14,15)10(12)13/h7-8,10H,3-6H2,1-2H3,(H,16,17)
InChIKeyFDTUNEPZXUYIKR-UHFFFAOYSA-N
XLogP3.90
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.32
LogP ≤ 53.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid?
The IUPAC name of 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid (CID 87340067) is 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid.
What is the SMILES notation for 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid?
The canonical SMILES for 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid is CC(C)CC(SCCCC(F)(F)C(F)F)C(=O)O.
What is the InChIKey of 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid?
The InChIKey is FDTUNEPZXUYIKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F4O2S/c1-7(2)6-8(9(16)17)18-5-3-4-11(14,15)10(12)13/h7-8,10H,3-6H2,1-2H3,(H,16,17).
What are the key properties of 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid?
4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid has a molecular weight of 290.32 g/mol, XLogP of 3.90, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoic acid is sourced from PubChem (CID 87340067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).