C27H28ClN3O4 — CID 22903535
N-[5-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-pyridinyl]-2-(4-hydroxybutoxy)benzamide (PubChem CID 22903535) has the molecular formula C27H28ClN3O4 and a molecular weight of 493.99 g/mol. Its IUPAC name is N-[5-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-pyridinyl]-2-(4-hydroxybutoxy)benzamide.
| Compound Name | N-[5-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-pyridinyl]-2-(4-hydroxybutoxy)benzamide |
|---|---|
| PubChem CID | 22903535 |
| Molecular Formula | C27H28ClN3O4 |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | N-[5-(7-chloro-2,3,4,5-tetrahydro-1-benzazepine-1-carbonyl)-2-pyridinyl]-2-(4-hydroxybutoxy)benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCCCc3cc(Cl)ccc32)cn1)c1ccccc1OCCCCO |
| InChI | InChI=1S/C27H28ClN3O4/c28-21-11-12-23-19(17-21)7-3-4-14-31(23)27(34)20-10-13-25(29-18-20)30-26(33)22-8-1-2-9-24(22)35-16-6-5-15-32/h1-2,8-13,17-18,32H,3-7,14-16H2,(H,29,30,33) |
| InChIKey | HRJLBFZYTISBQB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|