C20H27NO4 — CID 22904018
ethyl 5-[(2,2,3-trimethylchromene-6-carbonyl)amino]pentanoate (PubChem CID 22904018) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is ethyl 5-[(2,2,3-trimethylchromene-6-carbonyl)amino]pentanoate.
| Compound Name | ethyl 5-[(2,2,3-trimethylchromene-6-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 22904018 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | ethyl 5-[(2,2,3-trimethylchromene-6-carbonyl)amino]pentanoate |
| SMILES | CCOC(=O)CCCCNC(=O)c1ccc2c(c1)C=C(C)C(C)(C)O2 |
| InChI | InChI=1S/C20H27NO4/c1-5-24-18(22)8-6-7-11-21-19(23)15-9-10-17-16(13-15)12-14(2)20(3,4)25-17/h9-10,12-13H,5-8,11H2,1-4H3,(H,21,23) |
| InChIKey | QKVYWLGYPKDOTQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|