C16H16O3 — CID 22904590
4-(6,7-dimethylnaphthalen-2-yl)-4-oxobutanoic acid (PubChem CID 22904590) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-(6,7-dimethylnaphthalen-2-yl)-4-oxobutanoic acid.
| Compound Name | 4-(6,7-dimethylnaphthalen-2-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22904590 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 4-(6,7-dimethylnaphthalen-2-yl)-4-oxobutanoic acid |
| SMILES | Cc1cc2ccc(C(=O)CCC(=O)O)cc2cc1C |
| InChI | InChI=1S/C16H16O3/c1-10-7-12-3-4-13(9-14(12)8-11(10)2)15(17)5-6-16(18)19/h3-4,7-9H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | QORUDFGOLDCWGB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |