C23H13BrFNO4 — CID 2290535
[3-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate (PubChem CID 2290535) has the molecular formula C23H13BrFNO4 and a molecular weight of 466.26 g/mol. Its IUPAC name is [3-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate.
| Compound Name | [3-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 2290535 |
| Molecular Formula | C23H13BrFNO4 |
| Molecular Weight | 466.26 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | [3-[(Z)-[2-(4-bromophenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 2-fluorobenzoate |
| SMILES | O=C1OC(c2ccc(Br)cc2)=N/C1=C\c1cccc(OC(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C23H13BrFNO4/c24-16-10-8-15(9-11-16)21-26-20(23(28)30-21)13-14-4-3-5-17(12-14)29-22(27)18-6-1-2-7-19(18)25/h1-13H/b20-13- |
| InChIKey | HXLWFKYJTOSJEV-MOSHPQCFSA-N |
| XLogP | 5.15 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|