C19H29ClN2O — CID 22907290
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride (PubChem CID 22907290) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride.
| Compound Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride |
|---|---|
| PubChem CID | 22907290 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2)N1CCCC1 |
| InChI | InChI=1S/C19H28N2O.ClH/c1-18(2,3)14-10-13(17(20)21-8-6-7-9-21)11-15-16(14)22-12-19(15,4)5;/h10-11,20H,6-9,12H2,1-5H3;1H/b20-17-; |
| InChIKey | FVDALABVQJXZAA-BZHDPTRRSA-N |
| XLogP | 4.50 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|