About (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride (PubChem CID 22907290) has the molecular formula C19H29ClN2O
and a molecular weight of 336.91 g/mol. Its IUPAC name is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride.
Molecular Properties
| Compound Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride |
| PubChem CID | 22907290 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride |
| SMILES | Cl.[H]/N=C(/c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2)N1CCCC1 |
| InChI | InChI=1S/C19H28N2O.ClH/c1-18(2,3)14-10-13(17(20)21-8-6-7-9-21)11-15-16(14)22-12-19(15,4)5;/h10-11,20H,6-9,12H2,1-5H3;1H/b20-17-; |
| InChIKey | FVDALABVQJXZAA-BZHDPTRRSA-N |
| XLogP | 4.50 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride?
The IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride (CID 22907290) is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride.
What is the SMILES notation for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride?
The canonical SMILES for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride is Cl.[H]/N=C(/c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2)N1CCCC1.
What is the InChIKey of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride?
The InChIKey is FVDALABVQJXZAA-BZHDPTRRSA-N. The full InChI is InChI=1S/C19H28N2O.ClH/c1-18(2,3)14-10-13(17(20)21-8-6-7-9-21)11-15-16(14)22-12-19(15,4)5;/h10-11,20H,6-9,12H2,1-5H3;1H/b20-17-;.
What are the key properties of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride?
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride has a molecular weight of 336.91 g/mol, XLogP of 4.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-pyrrolidin-1-ylmethanimine;hydrochloride is sourced from PubChem (CID 22907290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).