About 4-cyanobenzoyl isothiocyanate
4-cyanobenzoyl isothiocyanate (PubChem CID 22908117) has the molecular formula C9H4N2OS
and a molecular weight of 188.21 g/mol. Its IUPAC name is 4-cyanobenzoyl isothiocyanate.
Molecular Properties
| Compound Name | 4-cyanobenzoyl isothiocyanate |
| PubChem CID | 22908117 |
| Molecular Formula | C9H4N2OS |
| Molecular Weight | 188.21 g/mol |
| Exact Mass | 188.00 |
| IUPAC Name | 4-cyanobenzoyl isothiocyanate |
| SMILES | N#Cc1ccc(C(=O)N=C=S)cc1 |
| InChI | InChI=1S/C9H4N2OS/c10-5-7-1-3-8(4-2-7)9(12)11-6-13/h1-4H |
| InChIKey | YHOPMABNZKSKRS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-cyanobenzoyl isothiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyanobenzoyl isothiocyanate?
The IUPAC name of 4-cyanobenzoyl isothiocyanate (CID 22908117) is 4-cyanobenzoyl isothiocyanate.
What is the SMILES notation for 4-cyanobenzoyl isothiocyanate?
The canonical SMILES for 4-cyanobenzoyl isothiocyanate is N#Cc1ccc(C(=O)N=C=S)cc1.
What is the InChIKey of 4-cyanobenzoyl isothiocyanate?
The InChIKey is YHOPMABNZKSKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4N2OS/c10-5-7-1-3-8(4-2-7)9(12)11-6-13/h1-4H.
What are the key properties of 4-cyanobenzoyl isothiocyanate?
4-cyanobenzoyl isothiocyanate has a molecular weight of 188.21 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyanobenzoyl isothiocyanate is sourced from PubChem (CID 22908117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).