C11H14F2O3S — CID 22910434
propan-2-yl 2-ethyl-3,6-difluorobenzenesulfonate (PubChem CID 22910434) has the molecular formula C11H14F2O3S and a molecular weight of 264.29 g/mol. Its IUPAC name is propan-2-yl 2-ethyl-3,6-difluorobenzenesulfonate.
| Compound Name | propan-2-yl 2-ethyl-3,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 22910434 |
| Molecular Formula | C11H14F2O3S |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | propan-2-yl 2-ethyl-3,6-difluorobenzenesulfonate |
| SMILES | CCc1c(F)ccc(F)c1S(=O)(=O)OC(C)C |
| InChI | InChI=1S/C11H14F2O3S/c1-4-8-9(12)5-6-10(13)11(8)17(14,15)16-7(2)3/h5-7H,4H2,1-3H3 |
| InChIKey | BZECMLKTFKMSSS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|