C22H32N4O4 — CID 22911277
methyl 3-[1-[3-[2-(butylcarbamoylamino)-3-methylphenoxy]propyl]imidazol-4-yl]propanoate (PubChem CID 22911277) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl 3-[1-[3-[2-(butylcarbamoylamino)-3-methylphenoxy]propyl]imidazol-4-yl]propanoate.
| Compound Name | methyl 3-[1-[3-[2-(butylcarbamoylamino)-3-methylphenoxy]propyl]imidazol-4-yl]propanoate |
|---|---|
| PubChem CID | 22911277 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | methyl 3-[1-[3-[2-(butylcarbamoylamino)-3-methylphenoxy]propyl]imidazol-4-yl]propanoate |
| SMILES | CCCCNC(=O)Nc1c(C)cccc1OCCCn1cnc(CCC(=O)OC)c1 |
| InChI | InChI=1S/C22H32N4O4/c1-4-5-12-23-22(28)25-21-17(2)8-6-9-19(21)30-14-7-13-26-15-18(24-16-26)10-11-20(27)29-3/h6,8-9,15-16H,4-5,7,10-14H2,1-3H3,(H2,23,25,28) |
| InChIKey | MPQWWHSFLMHQNY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|