C23H24N4S — CID 22911463
3-[5-[1-[2-(1-benzothiophen-3-yl)ethyl]piperidin-4-yl]-1H-pyrazol-3-yl]pyridine (PubChem CID 22911463) has the molecular formula C23H24N4S and a molecular weight of 388.54 g/mol. Its IUPAC name is 3-[5-[1-[2-(1-benzothiophen-3-yl)ethyl]piperidin-4-yl]-1H-pyrazol-3-yl]pyridine.
| Compound Name | 3-[5-[1-[2-(1-benzothiophen-3-yl)ethyl]piperidin-4-yl]-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 22911463 |
| Molecular Formula | C23H24N4S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-[5-[1-[2-(1-benzothiophen-3-yl)ethyl]piperidin-4-yl]-1H-pyrazol-3-yl]pyridine |
| SMILES | c1cncc(-c2cc(C3CCN(CCc4csc5ccccc45)CC3)[nH]n2)c1 |
| InChI | InChI=1S/C23H24N4S/c1-2-6-23-20(5-1)19(16-28-23)9-13-27-11-7-17(8-12-27)21-14-22(26-25-21)18-4-3-10-24-15-18/h1-6,10,14-17H,7-9,11-13H2,(H,25,26) |
| InChIKey | ROQIRYKFYBVIAN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |