C24H25N3S — CID 22911509
1-(2-naphthalen-1-ylethyl)-4-(3-thiophen-3-yl-1H-pyrazol-5-yl)piperidine (PubChem CID 22911509) has the molecular formula C24H25N3S and a molecular weight of 387.55 g/mol. Its IUPAC name is 1-(2-naphthalen-1-ylethyl)-4-(3-thiophen-3-yl-1H-pyrazol-5-yl)piperidine.
| Compound Name | 1-(2-naphthalen-1-ylethyl)-4-(3-thiophen-3-yl-1H-pyrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 22911509 |
| Molecular Formula | C24H25N3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-(2-naphthalen-1-ylethyl)-4-(3-thiophen-3-yl-1H-pyrazol-5-yl)piperidine |
| SMILES | c1ccc2c(CCN3CCC(c4cc(-c5ccsc5)n[nH]4)CC3)cccc2c1 |
| InChI | InChI=1S/C24H25N3S/c1-2-7-22-18(4-1)5-3-6-19(22)8-12-27-13-9-20(10-14-27)23-16-24(26-25-23)21-11-15-28-17-21/h1-7,11,15-17,20H,8-10,12-14H2,(H,25,26) |
| InChIKey | ZPYOFAKHHWUWEM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |