C34H38N4O5 — CID 22911546
2,6-dimethyl-4-[3-[3-(2-naphthalen-1-ylpiperidin-1-yl)propylcarbamoylamino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid (PubChem CID 22911546) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is 2,6-dimethyl-4-[3-[3-(2-naphthalen-1-ylpiperidin-1-yl)propylcarbamoylamino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid.
| Compound Name | 2,6-dimethyl-4-[3-[3-(2-naphthalen-1-ylpiperidin-1-yl)propylcarbamoylamino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 22911546 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 2,6-dimethyl-4-[3-[3-(2-naphthalen-1-ylpiperidin-1-yl)propylcarbamoylamino]phenyl]-1,4-dihydropyridine-3,5-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(c2cccc(NC(=O)NCCCN3CCCCC3c3cccc4ccccc34)c2)C(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C34H38N4O5/c1-21-29(32(39)40)31(30(33(41)42)22(2)36-21)24-12-7-13-25(20-24)37-34(43)35-17-9-19-38-18-6-5-16-28(38)27-15-8-11-23-10-3-4-14-26(23)27/h3-4,7-8,10-15,20,28,31,36H,5-6,9,16-19H2,1-2H3,(H,39,40)(H,41,42)(H2,35,37,43) |
| InChIKey | UEGAOPIUCMRGGC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 131.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|