C21H22N6O4S — CID 22911664
2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-(2-methylphenyl)propanoic acid (PubChem CID 22911664) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-(2-methylphenyl)propanoic acid.
| Compound Name | 2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 22911664 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1CC(NC(=O)CSc1nnc(-c2ccc(N=C(N)N)cc2)o1)C(=O)O |
| InChI | InChI=1S/C21H22N6O4S/c1-12-4-2-3-5-14(12)10-16(19(29)30)25-17(28)11-32-21-27-26-18(31-21)13-6-8-15(9-7-13)24-20(22)23/h2-9,16H,10-11H2,1H3,(H,25,28)(H,29,30)(H4,22,23,24) |
| InChIKey | PWMOUEMRHYKFRP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 169.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|