C21H22N6O4S — CID 67715440
methyl (2S)-2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-phenylpropanoate (PubChem CID 67715440) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 67715440 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | methyl (2S)-2-[[2-[[5-[4-(diaminomethylideneamino)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)CSc1nnc(-c2ccc(N=C(N)N)cc2)o1 |
| InChI | InChI=1S/C21H22N6O4S/c1-30-19(29)16(11-13-5-3-2-4-6-13)25-17(28)12-32-21-27-26-18(31-21)14-7-9-15(10-8-14)24-20(22)23/h2-10,16H,11-12H2,1H3,(H,25,28)(H4,22,23,24)/t16-/m0/s1 |
| InChIKey | ANQAVTNDVQVPBM-INIZCTEOSA-N |
| XLogP | 1.63 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|