C22H29NO2 — CID 22912537
N-[2-(7-pentoxy-8-prop-2-enylnaphthalen-1-yl)ethyl]acetamide (PubChem CID 22912537) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[2-(7-pentoxy-8-prop-2-enylnaphthalen-1-yl)ethyl]acetamide.
| Compound Name | N-[2-(7-pentoxy-8-prop-2-enylnaphthalen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 22912537 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-[2-(7-pentoxy-8-prop-2-enylnaphthalen-1-yl)ethyl]acetamide |
| SMILES | C=CCc1c(OCCCCC)ccc2cccc(CCNC(C)=O)c12 |
| InChI | InChI=1S/C22H29NO2/c1-4-6-7-16-25-21-13-12-18-10-8-11-19(14-15-23-17(3)24)22(18)20(21)9-5-2/h5,8,10-13H,2,4,6-7,9,14-16H2,1,3H3,(H,23,24) |
| InChIKey | HKVOZEACQCEYSE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|