C21H29FN4O6 — CID 22913016
N-[[3-[3-fluoro-4-[4-[2-(methoxymethoxy)ethoxyimino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 22913016) has the molecular formula C21H29FN4O6 and a molecular weight of 452.48 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-[2-(methoxymethoxy)ethoxyimino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-[2-(methoxymethoxy)ethoxyimino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 22913016 |
| Molecular Formula | C21H29FN4O6 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-[2-(methoxymethoxy)ethoxyimino]piperidin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COCOCCON=C1CCN(c2ccc(N3CC(CNC(C)=O)OC3=O)cc2F)CC1 |
| InChI | InChI=1S/C21H29FN4O6/c1-15(27)23-12-18-13-26(21(28)32-18)17-3-4-20(19(22)11-17)25-7-5-16(6-8-25)24-31-10-9-30-14-29-2/h3-4,11,18H,5-10,12-14H2,1-2H3,(H,23,27) |
| InChIKey | DHBHKZCJGSPZBU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|