C29H30F3NO4 — CID 22913363
(1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-pentylphenyl)-3-pyridinyl]benzoate (PubChem CID 22913363) has the molecular formula C29H30F3NO4 and a molecular weight of 513.56 g/mol. Its IUPAC name is (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-pentylphenyl)-3-pyridinyl]benzoate.
| Compound Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-pentylphenyl)-3-pyridinyl]benzoate |
|---|---|
| PubChem CID | 22913363 |
| Molecular Formula | C29H30F3NO4 |
| Molecular Weight | 513.56 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | (1,1,1-trifluoro-3-oxo-3-propoxypropan-2-yl) 4-[6-(4-pentylphenyl)-3-pyridinyl]benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C(=O)OC(C(=O)OCCC)C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C29H30F3NO4/c1-3-5-6-7-20-8-10-22(11-9-20)25-17-16-24(19-33-25)21-12-14-23(15-13-21)27(34)37-26(29(30,31)32)28(35)36-18-4-2/h8-17,19,26H,3-7,18H2,1-2H3 |
| InChIKey | CDFNKTOQLXNEMZ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.56 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|