About magnesium 2-methylpropyl phosphite
magnesium 2-methylpropyl phosphite (PubChem CID 22914060) has the molecular formula C4H9MgO3P
and a molecular weight of 160.39 g/mol. Its IUPAC name is magnesium 2-methylpropyl phosphite.
Molecular Properties
| Compound Name | magnesium 2-methylpropyl phosphite |
| PubChem CID | 22914060 |
| Molecular Formula | C4H9MgO3P |
| Molecular Weight | 160.39 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | magnesium 2-methylpropyl phosphite |
| SMILES | CC(C)COP([O-])[O-].[Mg+2] |
| InChI | InChI=1S/C4H9O3P.Mg/c1-4(2)3-7-8(5)6;/h4H,3H2,1-2H3;/q-2;+2 |
| InChIKey | BWZHGIXKAXWERM-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze magnesium 2-methylpropyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium 2-methylpropyl phosphite?
The IUPAC name of magnesium 2-methylpropyl phosphite (CID 22914060) is magnesium 2-methylpropyl phosphite.
What is the SMILES notation for magnesium 2-methylpropyl phosphite?
The canonical SMILES for magnesium 2-methylpropyl phosphite is CC(C)COP([O-])[O-].[Mg+2].
What is the InChIKey of magnesium 2-methylpropyl phosphite?
The InChIKey is BWZHGIXKAXWERM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O3P.Mg/c1-4(2)3-7-8(5)6;/h4H,3H2,1-2H3;/q-2;+2.
What are the key properties of magnesium 2-methylpropyl phosphite?
magnesium 2-methylpropyl phosphite has a molecular weight of 160.39 g/mol, XLogP of -0.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium 2-methylpropyl phosphite is sourced from PubChem (CID 22914060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).