About sodium propan-2-yl phosphite
sodium propan-2-yl phosphite (PubChem CID 21332940) has the molecular formula C3H7NaO3P-
and a molecular weight of 145.05 g/mol. Its IUPAC name is sodium propan-2-yl phosphite.
Molecular Properties
| Compound Name | sodium propan-2-yl phosphite |
| PubChem CID | 21332940 |
| Molecular Formula | C3H7NaO3P- |
| Molecular Weight | 145.05 g/mol |
| Exact Mass | 145.00 |
| IUPAC Name | sodium propan-2-yl phosphite |
| SMILES | CC(C)OP([O-])[O-].[Na+] |
| InChI | InChI=1S/C3H7O3P.Na/c1-3(2)6-7(4)5;/h3H,1-2H3;/q-2;+1 |
| InChIKey | IRKLMGSPVVJRLG-UHFFFAOYSA-N |
| XLogP | -3.64 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.05 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium propan-2-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium propan-2-yl phosphite?
The IUPAC name of sodium propan-2-yl phosphite (CID 21332940) is sodium propan-2-yl phosphite.
What is the SMILES notation for sodium propan-2-yl phosphite?
The canonical SMILES for sodium propan-2-yl phosphite is CC(C)OP([O-])[O-].[Na+].
What is the InChIKey of sodium propan-2-yl phosphite?
The InChIKey is IRKLMGSPVVJRLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O3P.Na/c1-3(2)6-7(4)5;/h3H,1-2H3;/q-2;+1.
What are the key properties of sodium propan-2-yl phosphite?
sodium propan-2-yl phosphite has a molecular weight of 145.05 g/mol, XLogP of -3.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium propan-2-yl phosphite is sourced from PubChem (CID 21332940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).