About cobalt;tripropan-2-yl phosphite
cobalt;tripropan-2-yl phosphite (PubChem CID 175896800) has the molecular formula C9H21CoO3P
and a molecular weight of 267.17 g/mol. Its IUPAC name is cobalt;tripropan-2-yl phosphite.
Molecular Properties
| Compound Name | cobalt;tripropan-2-yl phosphite |
| PubChem CID | 175896800 |
| Molecular Formula | C9H21CoO3P |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | cobalt;tripropan-2-yl phosphite |
| SMILES | CC(C)OP(OC(C)C)OC(C)C.[Co] |
| InChI | InChI=1S/C9H21O3P.Co/c1-7(2)10-13(11-8(3)4)12-9(5)6;/h7-9H,1-6H3; |
| InChIKey | IYPOGPCXBSLTOG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cobalt;tripropan-2-yl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt;tripropan-2-yl phosphite?
The IUPAC name of cobalt;tripropan-2-yl phosphite (CID 175896800) is cobalt;tripropan-2-yl phosphite.
What is the SMILES notation for cobalt;tripropan-2-yl phosphite?
The canonical SMILES for cobalt;tripropan-2-yl phosphite is CC(C)OP(OC(C)C)OC(C)C.[Co].
What is the InChIKey of cobalt;tripropan-2-yl phosphite?
The InChIKey is IYPOGPCXBSLTOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21O3P.Co/c1-7(2)10-13(11-8(3)4)12-9(5)6;/h7-9H,1-6H3;.
What are the key properties of cobalt;tripropan-2-yl phosphite?
cobalt;tripropan-2-yl phosphite has a molecular weight of 267.17 g/mol, XLogP of 3.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt;tripropan-2-yl phosphite is sourced from PubChem (CID 175896800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).