propan-2-yl hydrogen phosphite

C3H8O3P- — CID 20501230

IUPACpropan-2-yl hydrogen phosphite
SMILESCC(C)OP([O-])O
InChIInChI=1S/C3H8O3P/c1-3(2)6-7(4)5/h3-4H,1-2H3/q-1
InChIKeyDPNAQKPMCPKLML-UHFFFAOYSA-N
MW123.07 g/mol
LogP-0.01
Rot. Bonds2

About propan-2-yl hydrogen phosphite

propan-2-yl hydrogen phosphite (PubChem CID 20501230) has the molecular formula C3H8O3P- and a molecular weight of 123.07 g/mol. Its IUPAC name is propan-2-yl hydrogen phosphite.

Molecular Properties

Compound Namepropan-2-yl hydrogen phosphite
PubChem CID20501230
Molecular FormulaC3H8O3P-
Molecular Weight123.07 g/mol
Exact Mass123.02
IUPAC Namepropan-2-yl hydrogen phosphite
SMILESCC(C)OP([O-])O
InChIInChI=1S/C3H8O3P/c1-3(2)6-7(4)5/h3-4H,1-2H3/q-1
InChIKeyDPNAQKPMCPKLML-UHFFFAOYSA-N
XLogP-0.01
TPSA52.52 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500123.07
LogP ≤ 5-0.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze propan-2-yl hydrogen phosphite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl hydrogen phosphite?
The IUPAC name of propan-2-yl hydrogen phosphite (CID 20501230) is propan-2-yl hydrogen phosphite.
What is the SMILES notation for propan-2-yl hydrogen phosphite?
The canonical SMILES for propan-2-yl hydrogen phosphite is CC(C)OP([O-])O.
What is the InChIKey of propan-2-yl hydrogen phosphite?
The InChIKey is DPNAQKPMCPKLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3P/c1-3(2)6-7(4)5/h3-4H,1-2H3/q-1.
What are the key properties of propan-2-yl hydrogen phosphite?
propan-2-yl hydrogen phosphite has a molecular weight of 123.07 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl hydrogen phosphite is sourced from PubChem (CID 20501230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).