About propan-2-yl hydrogen phosphite
propan-2-yl hydrogen phosphite (PubChem CID 20501230) has the molecular formula C3H8O3P-
and a molecular weight of 123.07 g/mol. Its IUPAC name is propan-2-yl hydrogen phosphite.
Molecular Properties
| Compound Name | propan-2-yl hydrogen phosphite |
| PubChem CID | 20501230 |
| Molecular Formula | C3H8O3P- |
| Molecular Weight | 123.07 g/mol |
| Exact Mass | 123.02 |
| IUPAC Name | propan-2-yl hydrogen phosphite |
| SMILES | CC(C)OP([O-])O |
| InChI | InChI=1S/C3H8O3P/c1-3(2)6-7(4)5/h3-4H,1-2H3/q-1 |
| InChIKey | DPNAQKPMCPKLML-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 52.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.07 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl hydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl hydrogen phosphite?
The IUPAC name of propan-2-yl hydrogen phosphite (CID 20501230) is propan-2-yl hydrogen phosphite.
What is the SMILES notation for propan-2-yl hydrogen phosphite?
The canonical SMILES for propan-2-yl hydrogen phosphite is CC(C)OP([O-])O.
What is the InChIKey of propan-2-yl hydrogen phosphite?
The InChIKey is DPNAQKPMCPKLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3P/c1-3(2)6-7(4)5/h3-4H,1-2H3/q-1.
What are the key properties of propan-2-yl hydrogen phosphite?
propan-2-yl hydrogen phosphite has a molecular weight of 123.07 g/mol, XLogP of -0.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl hydrogen phosphite is sourced from PubChem (CID 20501230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).