C16H11ClFN5O2 — CID 22914501
5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-14-fluoro-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one (PubChem CID 22914501) has the molecular formula C16H11ClFN5O2 and a molecular weight of 359.75 g/mol. Its IUPAC name is 5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-14-fluoro-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one.
| Compound Name | 5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-14-fluoro-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one |
|---|---|
| PubChem CID | 22914501 |
| Molecular Formula | C16H11ClFN5O2 |
| Molecular Weight | 359.75 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 5-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-14-fluoro-2,4,10-triazatetracyclo[10.4.0.02,6.07,10]hexadeca-1(16),3,5,12,14-pentaen-11-one |
| SMILES | O=C1c2cc(F)ccc2-n2cnc(-c3noc(CCl)n3)c2C2CCN12 |
| InChI | InChI=1S/C16H11ClFN5O2/c17-6-12-20-15(21-25-12)13-14-11-3-4-22(11)16(24)9-5-8(18)1-2-10(9)23(14)7-19-13/h1-2,5,7,11H,3-4,6H2 |
| InChIKey | MAXSRJGLZBHJAJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|