C21H22N6O2S — CID 54249547
(7S)-5-[5-[[bis(prop-2-enyl)amino]methyl]-1,2,4-oxadiazol-3-yl]-14-thia-2,4,11-triazatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),3,5,15-tetraen-12-one (PubChem CID 54249547) has the molecular formula C21H22N6O2S and a molecular weight of 422.51 g/mol. Its IUPAC name is (7S)-5-[5-[[bis(prop-2-enyl)amino]methyl]-1,2,4-oxadiazol-3-yl]-14-thia-2,4,11-triazatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),3,5,15-tetraen-12-one.
| Compound Name | (7S)-5-[5-[[bis(prop-2-enyl)amino]methyl]-1,2,4-oxadiazol-3-yl]-14-thia-2,4,11-triazatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),3,5,15-tetraen-12-one |
|---|---|
| PubChem CID | 54249547 |
| Molecular Formula | C21H22N6O2S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (7S)-5-[5-[[bis(prop-2-enyl)amino]methyl]-1,2,4-oxadiazol-3-yl]-14-thia-2,4,11-triazatetracyclo[11.3.0.02,6.07,11]hexadeca-1(13),3,5,15-tetraen-12-one |
| SMILES | C=CCN(CC=C)Cc1nc(-c2ncn3c2[C@@H]2CCCN2C(=O)c2sccc2-3)no1 |
| InChI | InChI=1S/C21H22N6O2S/c1-3-8-25(9-4-2)12-16-23-20(24-29-16)17-18-14-6-5-10-26(14)21(28)19-15(7-11-30-19)27(18)13-22-17/h3-4,7,11,13-14H,1-2,5-6,8-10,12H2/t14-/m0/s1 |
| InChIKey | QVTZJXQLWWGIQQ-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|