C5H5N3O3 — CID 22915580
(2,5-dioxopyrrol-1-yl)urea (PubChem CID 22915580) has the molecular formula C5H5N3O3 and a molecular weight of 155.11 g/mol. Its IUPAC name is (2,5-dioxopyrrol-1-yl)urea.
| Compound Name | (2,5-dioxopyrrol-1-yl)urea |
|---|---|
| PubChem CID | 22915580 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | (2,5-dioxopyrrol-1-yl)urea |
| SMILES | NC(=O)NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C5H5N3O3/c6-5(11)7-8-3(9)1-2-4(8)10/h1-2H,(H3,6,7,11) |
| InChIKey | WMUCWHLEUXTKTR-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|