C7H8N2O3 — CID 67444117
N-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 67444117) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is N-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 67444117 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | N-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CCC(=O)NN1C(=O)C=CC1=O |
| InChI | InChI=1S/C7H8N2O3/c1-2-5(10)8-9-6(11)3-4-7(9)12/h3-4H,2H2,1H3,(H,8,10) |
| InChIKey | ZNALDVNNEBOGGN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|