C7H15NO — CID 22916505
N,N-dimethyl-1-prop-2-enoxyethanamine (PubChem CID 22916505) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is N,N-dimethyl-1-prop-2-enoxyethanamine.
| Compound Name | N,N-dimethyl-1-prop-2-enoxyethanamine |
|---|---|
| PubChem CID | 22916505 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | N,N-dimethyl-1-prop-2-enoxyethanamine |
| SMILES | C=CCOC(C)N(C)C |
| InChI | InChI=1S/C7H15NO/c1-5-6-9-7(2)8(3)4/h5,7H,1,6H2,2-4H3 |
| InChIKey | VDXHTNUIHHPZKY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|