C7H13NO — CID 134863305
N,N-dimethyl-1-prop-2-enoxyethenamine (PubChem CID 134863305) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is N,N-dimethyl-1-prop-2-enoxyethenamine.
| Compound Name | N,N-dimethyl-1-prop-2-enoxyethenamine |
|---|---|
| PubChem CID | 134863305 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N,N-dimethyl-1-prop-2-enoxyethenamine |
| SMILES | C=CCOC(=C)N(C)C |
| InChI | InChI=1S/C7H13NO/c1-5-6-9-7(2)8(3)4/h5H,1-2,6H2,3-4H3 |
| InChIKey | DBEDQSPZBDURCS-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|