C18H12ClF3O — CID 22918730
(2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydronaphthalen-1-one (PubChem CID 22918730) has the molecular formula C18H12ClF3O and a molecular weight of 336.74 g/mol. Its IUPAC name is (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydronaphthalen-1-one.
| Compound Name | (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 22918730 |
| Molecular Formula | C18H12ClF3O |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (2E)-2-[[4-chloro-3-(trifluoromethyl)phenyl]methylidene]-3,4-dihydronaphthalen-1-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)c(C(F)(F)F)c2)CCc2ccccc21 |
| InChI | InChI=1S/C18H12ClF3O/c19-16-8-5-11(10-15(16)18(20,21)22)9-13-7-6-12-3-1-2-4-14(12)17(13)23/h1-5,8-10H,6-7H2/b13-9+ |
| InChIKey | BECOEKUCGRQUNG-UKTHLTGXSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|