C25H34N2O3 — CID 22922288
butyl 4-[1-amino-2-(2-methoxyphenyl)ethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 22922288) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is butyl 4-[1-amino-2-(2-methoxyphenyl)ethyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | butyl 4-[1-amino-2-(2-methoxyphenyl)ethyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 22922288 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | butyl 4-[1-amino-2-(2-methoxyphenyl)ethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(c2ccccc2)(C(N)Cc2ccccc2OC)CC1 |
| InChI | InChI=1S/C25H34N2O3/c1-3-4-18-30-24(28)27-16-14-25(15-17-27,21-11-6-5-7-12-21)23(26)19-20-10-8-9-13-22(20)29-2/h5-13,23H,3-4,14-19,26H2,1-2H3 |
| InChIKey | SXNVPFOXRBMYOU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|