About 1-cycloheptylethanol
1-cycloheptylethanol (PubChem CID 22923644) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 1-cycloheptylethanol.
Molecular Properties
| Compound Name | 1-cycloheptylethanol |
| PubChem CID | 22923644 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 1-cycloheptylethanol |
| SMILES | CC(O)C1CCCCCC1 |
| InChI | InChI=1S/C9H18O/c1-8(10)9-6-4-2-3-5-7-9/h8-10H,2-7H2,1H3 |
| InChIKey | VACFFEJPHIAXMP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cycloheptylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cycloheptylethanol?
The IUPAC name of 1-cycloheptylethanol (CID 22923644) is 1-cycloheptylethanol.
What is the SMILES notation for 1-cycloheptylethanol?
The canonical SMILES for 1-cycloheptylethanol is CC(O)C1CCCCCC1.
What is the InChIKey of 1-cycloheptylethanol?
The InChIKey is VACFFEJPHIAXMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-8(10)9-6-4-2-3-5-7-9/h8-10H,2-7H2,1H3.
What are the key properties of 1-cycloheptylethanol?
1-cycloheptylethanol has a molecular weight of 142.24 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cycloheptylethanol is sourced from PubChem (CID 22923644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).